| CAS ID | 55-56-1 |
|---|---|
| IUPAC Name | (1E)-2-[6-[[amino-[(E)-[amino-(4-chloroanilino)methylidene]amino]methylidene]amino]hexyl]-1-[amino-(4-chloroanilino)methylidene]guanidine |
| Molecular Formula | C28H42Cl2N10O7 |
| Molecular Weight | |
| SMILES | C1=CC(=CC=C1NC(=NC(=NCCCCCCN=C(N)N=C(N)NC2=CC=C(C=C2)Cl)N)N)Cl |
| CAS ID | 55-56-1 |
|---|---|
| IUPAC Name | (1E)-2-[6-[[amino-[(E)-[amino-(4-chloroanilino)methylidene]amino]methylidene]amino]hexyl]-1-[amino-(4-chloroanilino)methylidene]guanidine |
| Molecular Formula | C28H42Cl2N10O7 |
| Molecular Weight | |
| SMILES | C1=CC(=CC=C1NC(=NC(=NCCCCCCN=C(N)N=C(N)NC2=CC=C(C=C2)Cl)N)N)Cl |
| 9552079 |
Synonym: chlorhexidine, chlorhexidinum, chlorhexidin, nolvasan, rotersept, tubulicid, fimeil, hexadol, soretol, cloresidina
| Melting Point | 134.0°C to 136.0°C |
| Assay Percent Range | 97.5% min. (HPLC) |
| Infrared Spectrum | Authentic |
| Formula Weight | 505.45 |
| Water | 1% max. |
| Chemical Name or Material | Chlorhexidine |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
