| CAS ID | 15718-51-1 |
|---|---|
| IUPAC Name | Cytidine 2':3'-cyclic monophosphate monosodium salt |
| Molecular Formula | C9H11N3NaO7P |
| Molecular Weight | |
| SMILES | C1=CN(C(=O)N=C1N)[C@H]2[C@H]3[C@@H]([C@H](O2)CO)OP(=O)(O3)[O-].[Na+] |
| CAS ID | 15718-51-1 |
|---|---|
| IUPAC Name | Cytidine 2':3'-cyclic monophosphate monosodium salt |
| Molecular Formula | C9H11N3NaO7P |
| Molecular Weight | |
| SMILES | C1=CN(C(=O)N=C1N)[C@H]2[C@H]3[C@@H]([C@H](O2)CO)OP(=O)(O3)[O-].[Na+] |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
