| CAS ID | 5874-57-7 |
|---|---|
| IUPAC Name | methyl (2R)-2-amino-3-hydroxypropanoate;hydrochloride |
| Molecular Formula | C4H10ClNO3 |
| Molecular Weight | |
| SMILES | CC(N(C)S(=O)(=O)C1=CC=C(Br)C=C1)C1=NC2=CC=CC=C2C(=O)N1C1=CC=C(Br)C=C1 |
| CAS ID | 5874-57-7 |
|---|---|
| IUPAC Name | methyl (2R)-2-amino-3-hydroxypropanoate;hydrochloride |
| Molecular Formula | C4H10ClNO3 |
| Molecular Weight | |
| SMILES | CC(N(C)S(=O)(=O)C1=CC=C(Br)C=C1)C1=NC2=CC=CC=C2C(=O)N1C1=CC=C(Br)C=C1 |
| 11446470 |
Synonym: d-serine methyl ester hydrochloride, h-d-ser-ome.hcl, r-methyl 2-amino-3-hydroxypropanoate hydrochloride, d-serine, methyl ester, hydrochloride, d-serine methyl ester hcl, methyl 2r-2-amino-3-hydroxypropanoate hydrochloride, d-ser-ome hcl, cycloserine impurity 2, h-d-ser-ome.hci
| Assay Percent Range | 98% |
| Linear Formula | HOCH2CH(NH2)CO2CH3·HCl |
| Infrared Spectrum | Authentic |
| Packaging | Glass bottle |
| Formula Weight | 155.58 |
| Specific Rotation | −2.5° to −4.5° (20°C, 589nm) (C=4, methanol) |
| Physical Form | Liquid |
| Color | Colorless to Yellow |
| Melting Point | 152.0°C to 161.0°C |
| Chemical Name or Material | D-Serine methyl ester hydrochloride |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
