| CAS ID | Â 541-02-6 |
|---|---|
| IUPAC Name | 2,2,4,4,6,6,8,8,10,10-decamethyl-1,3,5,7,9,2,4,6,8,10- |
| Molecular Formula | C10H30O5Si5 |
| Molecular Weight | |
| SMILES | C[Si]1(O[Si](O[Si](O[Si](O[Si](O1)(C)C)(C)C)(C)C)(C)C)C |
| CAS ID | Â 541-02-6 |
|---|---|
| IUPAC Name | 2,2,4,4,6,6,8,8,10,10-decamethyl-1,3,5,7,9,2,4,6,8,10- |
| Molecular Formula | C10H30O5Si5 |
| Molecular Weight | |
| SMILES | C[Si]1(O[Si](O[Si](O[Si](O[Si](O1)(C)C)(C)C)(C)C)(C)C)C |
| 10913 |
Synonym : decamethylcyclopentasiloxane, cyclopentasiloxane, decamethyl, cyclomethicone 5, dimethylsiloxane pentamer, dow corning 345 fluid, nuc silicone vs 7158, dow corning 345, silicon sf 1202, cyclic dimethylsiloxane pentamer, dekamethylcyklopentasiloxan
| Color | Colorless |
| Melting Point | -38°C |
| Boiling Point | 210°C |
| Formula Weight | 370.77 |
| Physical Form | Clear Liquid at 20°C |
| Chemical Name or Material | Decamethylcyclopentasiloxane |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
