| CAS ID | 132-64-9 |
|---|---|
| IUPAC Name | Dibenzofuran |
| Molecular Formula | C12H8O |
| Molecular Weight | |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3O2 |
| CAS ID | 132-64-9 |
|---|---|
| IUPAC Name | Dibenzofuran |
| Molecular Formula | C12H8O |
| Molecular Weight | |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3O2 |
| 568 |
Synonym : dibenzo b,d furan, diphenylene oxide, 2,2′-biphenylene oxide, 2,2′-biphenylylene oxide, dibenzofurans, dibenzol b,d furan, dibenzofurane, 1,1′-biphenyl-2,2′-diyl oxide
| Color | White |
| Melting Point | 83°C |
| Boiling Point | 288°C |
| UN Number | 3077 |
| Formula Weight | 168.20 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | Dibenzofuran |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
