| CAS ID | 120-46-7 |
|---|---|
| IUPAC Name | 1,3-diphenylpropane-1,3-dione |
| Molecular Formula | C15H12O2 |
| Molecular Weight | |
| SMILES | C1=CC=C(C=C1)C(=O)CC(=O)C2=CC=CC=C2 |
| CAS ID | 120-46-7 |
|---|---|
| IUPAC Name | 1,3-diphenylpropane-1,3-dione |
| Molecular Formula | C15H12O2 |
| Molecular Weight | |
| SMILES | C1=CC=C(C=C1)C(=O)CC(=O)C2=CC=CC=C2 |
| 8433 |
Synonym: dibenzoylmethane, 1,3-diphenyl-1,3-propanedione, 2-benzoylacetophenone, phenyl phenacyl ketone, 1,3-propanedione, 1,3-diphenyl, rhodiastab 83, omega-benzoylacetophenone, dibenzoyl-methane, karenzu dk2, unii-ans7me8okc
| Boiling Point | 221°C |
| Color | Undesignated |
| Melting Point | 78°C |
| Formula Weight | 224.26 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 1,3-Diphenyl-1,3-propanedione |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
