| CAS ID | 85116-37-6 |
|---|---|
| IUPAC Name | chloro-[(1R,3R,4S,5S)-4,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-[(1S,3R,4S,5S)-4,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]borane |
| Molecular Formula | C20H34BCl |
| Molecular Weight | |
| SMILES | B(C1CC2CC(C1C)C2(C)C)(C3CC4CC(C3C)C4(C)C)Cl |
| CAS ID | 85116-37-6 |
|---|---|
| IUPAC Name | chloro-[(1R,3R,4S,5S)-4,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-[(1S,3R,4S,5S)-4,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]borane |
| Molecular Formula | C20H34BCl |
| Molecular Weight | |
| SMILES | B(C1CC2CC(C1C)C2(C)C)(C3CC4CC(C3C)C4(C)C)Cl |
| 131632371 |
| Boiling Point | 69°C |
| Color | Yellow |
| UN Number | 2924 |
| Formula Weight | 320.75 |
| Physical Form | Clear Liquid at 20°C |
| Chemical Name or Material | (-)-B-Chlorodiisopinocampheylborane (60% in Hexane, ca. 1.7mol/L) |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
