| CAS ID | 80-10-4 |
|---|---|
| IUPAC Name | dichlorodiphenylsilane |
| Molecular Formula | C12H10Cl2Si |
| Molecular Weight | |
| SMILES | Cl[Si](Cl)(C1=CC=CC=C1)C1=CC=CC=C1 |
| CAS ID | 80-10-4 |
|---|---|
| IUPAC Name | dichlorodiphenylsilane |
| Molecular Formula | C12H10Cl2Si |
| Molecular Weight | |
| SMILES | Cl[Si](Cl)(C1=CC=CC=C1)C1=CC=CC=C1 |
| 6627 |
Synonym : diphenyldichlorosilane, silane, dichlorodiphenyl, dichloro diphenyl silane, diphenylsilicon dichloride, diphenylsilyl dichloride, dichlor-difenylsilan, diphenyl dichlorosilane, dichlor-difenylsilan czech, hsdb 316, benzene, 1,1′-dichlorosilylene bis
| Color | Yellow |
| Boiling Point | 303°C |
| UN Number | 1769 |
| Formula Weight | 253.20 |
| Physical Form | Clear Liquid at 20°C |
| Chemical Name or Material | Dichlorodiphenylsilane |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
