![Chemical structure of [chloro(phenyl)phosphoryl]benzene](https://www.sarchemlabs.com/wp-content/uploads/2021/11/S2822.png)
| CAS ID | 1499-21-4 |
|---|---|
| IUPAC Name | chloro(phenyl)phosphoryl]benzene |
| Molecular Formula | C12H10ClOP |
| Molecular Weight | |
| SMILES | C1=CC=C(C=C1)P(=O)(C2=CC=CC=C2)Cl |
| CAS ID | 1499-21-4 |
|---|---|
| IUPAC Name | chloro(phenyl)phosphoryl]benzene |
| Molecular Formula | C12H10ClOP |
| Molecular Weight | |
| SMILES | C1=CC=C(C=C1)P(=O)(C2=CC=CC=C2)Cl |
| 73910 |
Synonym: diphenylphosphinic chloride, diphenylphosphinyl chloride, phosphinic chloride, diphenyl, diphenylphosphinoyl chloride, chlorodiphenylphosphine oxide, dpp-cl, unii-5gp30gy04v, diphenyl phosphinic chloride, diphenylphosphinochloridic acid, diphenylphosphinic acid chloride
| Color | Yellow |
| Boiling Point | 222°C |
| UN Number | 2920 |
| Formula Weight | 236.63 |
| Physical Form | Clear Liquid at 20°C |
| Chemical Name or Material | Diphenylphosphinic Chloride |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
