![Chemical structure of [chloro(phenyl)phosphoryl]benzene](https://www.sarchemlabs.com/wp-content/uploads/2021/11/S2822.png)
| CAS ID | 1499-21-4 |
|---|---|
| IUPAC Name | chloro(phenyl)phosphoryl]benzene |
| Molecular Formula | C12H10ClOP |
| Molecular Weight | |
| SMILES | C1=CC=C(C=C1)P(=O)(C2=CC=CC=C2)Cl |
| CAS ID | 1499-21-4 |
|---|---|
| IUPAC Name | chloro(phenyl)phosphoryl]benzene |
| Molecular Formula | C12H10ClOP |
| Molecular Weight | |
| SMILES | C1=CC=C(C=C1)P(=O)(C2=CC=CC=C2)Cl |
| 73910 |
Synonym: diphenylphosphinic chloride, diphenylphosphinyl chloride, phosphinic chloride, diphenyl, diphenylphosphinoyl chloride, chlorodiphenylphosphine oxide, dpp-cl, unii-5gp30gy04v, diphenyl phosphinic chloride, diphenylphosphinochloridic acid, diphenylphosphinic acid chloride
| Color | Yellow |
| Boiling Point | 222°C |
| UN Number | 2920 |
| Formula Weight | 236.63 |
| Physical Form | Clear Liquid at 20°C |
| Chemical Name or Material | Diphenylphosphinic Chloride |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
Chemical formula of Diphenylphosphinyl chloride is C12H10ClOP. Its reactivity and uses in organic synthesis and chemical research arise from a phosphorus core bound to a chlorine atom and two phenyl groups.
The molecular weight of Diphenylphosphinyl chloride is 236.63 g/mol. The atomic masses of carbon, hydrogen, oxygen, phosphorous, and chlorine in their chemical composition define this value.
Under normal conditions, boiling point of Diphenylphosphinyl chloride is about 220°C. This thermal characteristic affects its handling, storage, and use in chemical synthesis techniques that require regulated temperature settings.
The melting point of Diphenylphosphinyl chloride is roughly 74°C. This feature defines its stability, crystallization behavior, and suitability for different chemical uses in controlled surroundings.
The diphenylphosphine chloride chemical structure consists of a phosphorous atom coupled to two phenyl groups, an oxygen atom and a chlorine atom. This arrangement affects its chemical reactivity, which is why it is useful in synthetic and industrial chemistry.
