| CAS ID | 838-57-3 |
|---|---|
| IUPAC Name | ethyl 3-(4-nitrophenyl)-3-oxopropanoate |
| Molecular Formula | C11H10NO5- |
| Molecular Weight | |
| SMILES | CCOC(=O)CC(=O)C1=CC=C(C=C1)[N+](=O)[O-] |
| CAS ID | 838-57-3 |
|---|---|
| IUPAC Name | ethyl 3-(4-nitrophenyl)-3-oxopropanoate |
| Molecular Formula | C11H10NO5- |
| Molecular Weight | |
| SMILES | CCOC(=O)CC(=O)C1=CC=C(C=C1)[N+](=O)[O-] |
| 13281 |
Synonym: ethyl 4-nitrobenzoylacetate, ethyl 3-4-nitrophenyl-3-oxopropanoate, ethyl p-nitrobenzoyl acetate, ethyl 4-nitrobenzoyl acetate, p-nitrobenzoyl acetic acid ethyl ester, ethyl p-nitrobenzoylacetate, 4-nitrobenzoylacetic acid ethyl ester, ethyl 4-nitro-beta-oxobenzenepropanoate, 4-nitrobenzoyl acetic acid ethyl ester, benzenepropanoic acid, 4-nitro-beta-oxo-, ethyl ester
| Color | Undesignated |
| Melting Point | 86°C |
| Formula Weight | 237.21 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | Ethyl (4-Nitrobenzoyl)acetate |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
