| CAS ID | 71989-18-9 |
|---|---|
| IUPAC Name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid |
| Molecular Formula | C22H24NO5 |
| Molecular Weight | |
| SMILES | CC(C)(C)OC(=O)CCC(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
| CAS ID | 71989-18-9 |
|---|---|
| IUPAC Name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid |
| Molecular Formula | C22H24NO5 |
| Molecular Weight | |
| SMILES | CC(C)(C)OC(=O)CCC(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
| 2724637 |
Synonym: fmoc-glu otbu-oh, fmoc-l-glutamic acid 5-tert-butyl ester, 2s-5-tert-butoxy-2-9h-fluoren-9-ylmethoxy carbonyl amino-5-oxopentanoic acid, s-2-9h-fluoren-9-yl methoxy carbonyl amino-5-tert-butoxy-5-oxopentanoic acid, n-fmoc-l-glutamic acid 5-tert-butyl ester, fmoc-glu obut, fmoc-glu tbu, fmoc-l-glu otbu, pubchem12950, fmoc-l-glu otbu-oh
| Melting Point | 90°C |
| Color | White |
| Formula Weight | 425.48 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 5-tert-Butyl N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-glutamate Hydrate |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
