| CAS ID | 70-18-8 |
|---|---|
| IUPAC Name | (2S)-2-amino-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid |
| Molecular Formula | C10H17N3O6S |
| Molecular Weight | |
| SMILES | C(CC(=O)NC(CS)C(=O)NCC(=O)O)C(C(=O)O)N |
| CAS ID | 70-18-8 |
|---|---|
| IUPAC Name | (2S)-2-amino-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid |
| Molecular Formula | C10H17N3O6S |
| Molecular Weight | |
| SMILES | C(CC(=O)NC(CS)C(=O)NCC(=O)O)C(C(=O)O)N |
| 124886 |
Synonym: glutathione, l-glutathione, glutathion, glutathione-sh, glutinal, isethion, tathion, reduced glutathione, deltathione, neuthion
| Packaging | Glass Bottle |
| Specific Rotation Condition | − 16.50 (20.00°C c=2,H2O) |
| Specific Rotation | − 16.50 |
| Sulfated Ash | 0.1% max. (800°C) |
| Melting Point | 182.0°C to 192.0°C |
| Loss on Drying | 0.5% max. (105°C, 3 hrs) |
| Color | White |
| Infrared Spectrum | Authentic |
| Assay Percent Range | 97.5% min. (Iodimetry) |
| Beilstein | 04,II,931 |
| Merck Index | 15,4511 |
| Solubility Information | Solubility in water: very soluble. Other solubilities: freely soluble in dilute alcohol and dimethyl-, formamide, almost insoluble in ethanol |
| Formula Weight | 307.32 |
| Physical Form | Crystalline Powder |
| Grade | Analysis |
| Chemical Name or Material | Glutathione, For analysis, Reduced |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
