| CAS ID | 60-01-5 |
|---|---|
| IUPAC Name | 2,3-di(butanoyloxy)propyl butanoate |
| Molecular Formula | C15H26O6 |
| Molecular Weight | |
| SMILES | CCCC(=O)OCC(COC(=O)CCC)OC(=O)CCC |
| CAS ID | 60-01-5 |
|---|---|
| IUPAC Name | 2,3-di(butanoyloxy)propyl butanoate |
| Molecular Formula | C15H26O6 |
| Molecular Weight | |
| SMILES | CCCC(=O)OCC(COC(=O)CCC)OC(=O)CCC |
| 6050 |
Synonym: tributyrin, glyceryl tributyrate, glycerol tributyrate, tributin, butyrin, butyryl triglyceride, propane-1,2,3-triyl tributyrate, glycerol tributanoate, glyceroltributyrin, tri-n-butyrin
| Melting Point | -75°C |
| Color | Yellow |
| Boiling Point | 190°C |
| Formula Weight | 302.37 |
| Physical Form | Clear Liquid at 20°C |
| Chemical Name or Material | Tributyrin |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
