| CAS ID | 1738-77-8 |
|---|---|
| IUPAC Name | benzyl (2S)-2-amino-4-methylpentanoate;4-methylbenzenesulfonic acid |
| Molecular Formula | C20H27NO5S |
| Molecular Weight | |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.CC(C)CC(C(=O)OCC1=CC=CC=C1)NShow Less |
| CAS ID | 1738-77-8 |
|---|---|
| IUPAC Name | benzyl (2S)-2-amino-4-methylpentanoate;4-methylbenzenesulfonic acid |
| Molecular Formula | C20H27NO5S |
| Molecular Weight | |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.CC(C)CC(C(=O)OCC1=CC=CC=C1)NShow Less |
| 6451312 |
Synonym: l-leucine benzyl ester p-toluenesulfonate salt, l-leucine benzyl ester p-toluenesulfonate, h-leu-obzl.tosoh, l-leucine benzyl ester tosylate, o-benzyl-l-leucine toluene-p-sulphonate, s-benzyl 2-amino-4-methylpentanoate 4-methylbenzenesulfonate, benzyl 2s-2-amino-4-methylpentanoate; para-toluene sulfonate, leu-obzl tosoh, h-leu-obzl.tos, h-leu-obzl tsoh
| Melting Point | 158°C |
| Color | White |
| Formula Weight | 393.50 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | L-Leucine Benzyl Ester p-Toluenesulfonate |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
