| CAS ID | 156-39-8 |
|---|---|
| IUPAC Name | 3-(4-hydroxyphenyl)-2-oxopropanoic acid |
| Molecular Formula | C9H8O4 |
| Molecular Weight | |
| SMILES | C1=CC(=CC=C1CC(=O)C(=O)O)O |
| CAS ID | 156-39-8 |
|---|---|
| IUPAC Name | 3-(4-hydroxyphenyl)-2-oxopropanoic acid |
| Molecular Formula | C9H8O4 |
| Molecular Weight | |
| SMILES | C1=CC(=CC=C1CC(=O)C(=O)O)O |
| 979 |
Synonym: 4-hydroxyphenylpyruvic acid, testacid, 3-4-hydroxyphenyl-2-oxopropanoic acid, p-hydroxyphenylpyruvic acid, testacide, 4-hydroxyphenylpyruvate, 3-4-hydroxyphenyl pyruvic acid, p-hydroxyphenyl pyruvic acid, 3-p-hydroxyphenyl pyruvic acid, 3-p-hydroxyphenyl-2-oxopropanoic acid
| Color | Undesignated |
| Formula Weight | 180.16 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 4-Hydroxyphenylpyruvic Acid |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
