| CAS ID | 64044-51-5 |
|---|---|
| IUPAC Name | Lactose Monohydrate |
| Molecular Formula | C12H24O12 |
| Molecular Weight | |
| SMILES | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)O)CO)O)O)O)O.O |
| CAS ID | 64044-51-5 |
|---|---|
| IUPAC Name | Lactose Monohydrate |
| Molecular Formula | C12H24O12 |
| Molecular Weight | |
| SMILES | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)O)CO)O)O)O)O.O |
| 133126686 |
Synonym: d-lactose monohydrate, d-+-lactosemonohydrate
| Alpha Vector | Lactose Monohydrate |
| Acidity | Pass Test |
| Decomposition Information | >219°C |
| Appearance | Pass Test |
| Density | 1.525g/cm³ |
| Color | White |
| Melting Point | 219°C |
| Ignition Residue | 0.1% max. |
| Loss on Drying | 0.5% max. |
| Identification | Pass Test |
| Packaging | Fiber Drum |
| Specific Rotation | 54.4 to 55.9° (+ or -) |
| Residual Solvents | Meets Requirements |
| Formula Weight | 360.32 |
| Physical Form | Solid |
| Grade | NF |
| Vapor Pressure | Negligible |
| Water | 4.5 to 5.5% |
| Chemical Name or Material | D-Lactose Monohydrate |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
