| CAS ID | 133310-19-7 |
|---|---|
| IUPAC Name | Lamotrigine N2-Glucuronide |
| Molecular Formula | C15H16Cl2N5O6+ |
| Molecular Weight | |
| SMILES | OC(=O)[C@@H]1O[C@@H]([C@@H](O)[C@H](O)[C@H]1O)[N+]2=[13C](N=[13C]([13C](=N2)C3=C(C(=CC=C3)Cl)Cl)N)N |
| CAS ID | 133310-19-7 |
|---|---|
| IUPAC Name | Lamotrigine N2-Glucuronide |
| Molecular Formula | C15H16Cl2N5O6+ |
| Molecular Weight | |
| SMILES | OC(=O)[C@@H]1O[C@@H]([C@@H](O)[C@H](O)[C@H]1O)[N+]2=[13C](N=[13C]([13C](=N2)C3=C(C(=CC=C3)Cl)Cl)N)N |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
