| CAS ID | 50-65-7 |
|---|---|
| IUPAC Name | 5-chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxybenzamide |
| Molecular Formula | C13H8Cl2N2O4 |
| Molecular Weight | |
| SMILES | OC1=CC=C(Cl)C=C1C(=O)NC1=CC=C(C=C1Cl)[N+]([O-])=O |
| CAS ID | 50-65-7 |
|---|---|
| IUPAC Name | 5-chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxybenzamide |
| Molecular Formula | C13H8Cl2N2O4 |
| Molecular Weight | |
| SMILES | OC1=CC=C(Cl)C=C1C(=O)NC1=CC=C(C=C1Cl)[N+]([O-])=O |
| Melting Point | 225°C to 233°C |
| Vapor Pressure | Very low at room temp |
| Loss on Drying | ≤0.5% |
| Color | Green-yellow |
| Sulfated Ash | ≤0.1% |
| UN Number | UN3077 |
| Beilstein | 2820605 |
| Solubility Information | Soluble in methanol:acetone [1:1] (50mg/mL). |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
