| CAS ID | 6409-77-4 |
|---|---|
| IUPAC Name | 4-amino-1,3-dihydroxy-9,10-dioxoanthracene-2-sulfonic acid;molecular hydrogen;sodium |
| Molecular Formula | C14H8NNaO7S |
| Molecular Weight | |
| SMILES | [HH].C1=CC=C2C(=C1)C(=O)C3=C(C2=O)C(=C(C(=C3N)O)S(=O)(=O)O)O.[Na] |
| CAS ID | 6409-77-4 |
|---|---|
| IUPAC Name | 4-amino-1,3-dihydroxy-9,10-dioxoanthracene-2-sulfonic acid;molecular hydrogen;sodium |
| Molecular Formula | C14H8NNaO7S |
| Molecular Weight | |
| SMILES | [HH].C1=CC=C2C(=C1)C(=O)C3=C(C2=O)C(=C(C(=C3N)O)S(=O)(=O)O)O.[Na] |
| 131675027 |
Synonym: Kernechtrot, NFR
| Formula Weight | 357.27 |
| Physical Form | Crystal-Powder at 20°C |
| Color | Undesignated |
| Chemical Name or Material | Nuclear Fast Red |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
