| CAS ID | 135-70-6 |
|---|---|
| IUPAC Name | 1-phenyl-4-(4-phenylphenyl)benzene |
| Molecular Formula | C24H18 |
| Molecular Weight | |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C3=CC=C(C=C3)C4=CC=CC=C4 |
| CAS ID | 135-70-6 |
|---|---|
| IUPAC Name | 1-phenyl-4-(4-phenylphenyl)benzene |
| Molecular Formula | C24H18 |
| Molecular Weight | |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C3=CC=C(C=C3)C4=CC=CC=C4 |
| 8677 |
Synonym: p-quaterphenyl, 1,1′:4′,1:4,1′-quaterphenyl, benzerythrene, quadriphenyl, p-tetraphenyl, 4,4′-diphenylbiphenyl, p,p’-quaterphenyl, 4-quaterphenyl, unii-g8aqm6d0rk, 1-phenyl-4-4-phenylphenyl benzene
| Color | White |
| Formula Weight | 306.41 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | p-Quaterphenyl |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
