| CAS ID | 92-94-4 |
|---|---|
| IUPAC Name | 1,4-diphenylbenzene |
| Molecular Formula | C18H14 |
| Molecular Weight | |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C3=CC=CC=C3 |
| CAS ID | 92-94-4 |
|---|---|
| IUPAC Name | 1,4-diphenylbenzene |
| Molecular Formula | C18H14 |
| Molecular Weight | |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C3=CC=CC=C3 |
| 7115 |
Synonym: p-terphenyl, 1,1′:4′,1-terphenyl, p-diphenylbenzene, p-triphenyl, santowax p, 4-phenylbiphenyl, 4-phenyldiphenyl, para-terphenyl, biphenyl, 4-phenyl, pyrogallol tannin
| Boiling Point | 389°C |
| Melting Point | 214°C |
| Color | White |
| Formula Weight | 230.31 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | p-Terphenyl (purified by sublimation) |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
