| CAS ID | 602-94-8 |
|---|---|
| IUPAC Name | Pentafluorobenzoic acid |
| Molecular Formula | C7HF5O2 |
| Molecular Weight | |
| SMILES | OC(=O)C1=C(F)C(F)=C(F)C(F)=C1F |
| CAS ID | 602-94-8 |
|---|---|
| IUPAC Name | Pentafluorobenzoic acid |
| Molecular Formula | C7HF5O2 |
| Molecular Weight | |
| SMILES | OC(=O)C1=C(F)C(F)=C(F)C(F)=C1F |
| 11770 |
Synonym: pentafluorobenzoic acid, perfluorobenzoic acid, benzoic acid, pentafluoro, benzoic acid, 2,3,4,5,6-pentafluoro, 2,3,4,5,6-pentafluorobenzoicacid, pubchem2320, acmc-1b1wz, 4-09-00-00956 beilstein handbook reference, ksc355e3b, rarechem al bo 0017
| Quantity | 5g |
| Melting Point | 104°C |
| Color | White |
| Formula Weight | 212.08 |
| Physical Form | Crystal-Powder at 20°C |
| Percent Purity | ≥98.0% (GC,T) |
| Chemical Name or Material | Pentafluorobenzoic Acid |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
