| CAS ID | 61-76-7 |
|---|---|
| IUPAC Name | hydrogen 3-[1-hydroxy-2-(methylamino)ethyl]phenol chloride |
| Molecular Formula | C9H14ClNO2 |
| Molecular Weight | |
| SMILES | [H+].[Cl-].CNCC(O)C1=CC=CC(O)=C1 |
| CAS ID | 61-76-7 |
|---|---|
| IUPAC Name | hydrogen 3-[1-hydroxy-2-(methylamino)ethyl]phenol chloride |
| Molecular Formula | C9H14ClNO2 |
| Molecular Weight | |
| SMILES | [H+].[Cl-].CNCC(O)C1=CC=CC(O)=C1 |
| 5284443 |
Synonym: phenylephrine hydrochloride, phenylephrine hcl, l-phenylephrine hydrochloride, metaoxedrine chloride, neosympatol, synethenate, almefrin, consdrin, emagrin, fenilfar
| Melting Point | 143°C |
| Color | White |
| Formula Weight | 203.67 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | (R)-Phenylephrine Hydrochloride |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
The phenylephrine molecular weight is about 167.21 g/mol. Phenethylamine backbone with hydroxyl and methyl functionalities, this computation is built and helps to explain its pharmacological efficacy in different medical formulations.
Phenylephrine powder is a key ingredient in pharmaceutical formulations for ophthalmic solutions and decongestants. Its solubility and stability make it suitable for tablet, pill, and liquid preparations, guaranteeing exact dosage distribution for medicinal uses.
The purity and stability of phenylephrine depend on its melting point, HCl, which is vital. Any departure from the specified melting range can point to contaminants or deterioration, influencing the pharmacological formulation's effectiveness.
Nasal decongestants, ocular solutions, and injectable formulations all use phenylephrine, which is mostly a vasoconstrictor. It is also used in surgical environments to control hypotension by preserving blood pressure values throughout operations.
Its pharmacokinetics and bioavailability change with the phenylephrine molecular weight. Perfect molecular weight guarantees correct formulation, influencing therapeutic efficacy and absorption rates in medical therapies.
