| CAS ID | 1921-70-6 |
|---|---|
| IUPAC Name | 2,6,10,14-tetramethylpentadecane |
| Molecular Formula | C19H40 |
| Molecular Weight | |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCC(C)C |
| CAS ID | 1921-70-6 |
|---|---|
| IUPAC Name | 2,6,10,14-tetramethylpentadecane |
| Molecular Formula | C19H40 |
| Molecular Weight | |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCC(C)C |
| 15979 |
Synonym: pristane, norphytane, bute hydrocarbon, norphytan, pristan, pentadecane, 2,6,10,14-tetramethyl, meso-pristane, 2,6,10,10-tetramethylpentadecane, meso-form, norphytane, robuoy
| Melting Point | -99°C |
| Color | Yellow |
| Boiling Point | 299°C |
| Formula Weight | 268.53 |
| Physical Form | Clear Liquid at 20°C |
| Chemical Name or Material | 2,6,10,14-Tetramethylpentadecane |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
