| CAS ID | 54-47-7 |
|---|---|
| IUPAC Name | (4-formyl-5-hydroxy-6-methylpyridin-3-yl)methyl dihydrogen phosphate |
| Molecular Formula | C8H10NO6P |
| Molecular Weight | |
| SMILES | CC1=NC=C(COP(O)(O)=O)C(C=O)=C1O |
| CAS ID | 54-47-7 |
|---|---|
| IUPAC Name | (4-formyl-5-hydroxy-6-methylpyridin-3-yl)methyl dihydrogen phosphate |
| Molecular Formula | C8H10NO6P |
| Molecular Weight | |
| SMILES | CC1=NC=C(COP(O)(O)=O)C(C=O)=C1O |
| 1051 |
Synonym: pyridoxal phosphate, codecarboxylase, pyridoxal 5-phosphate, pyridoxal 5′-phosphate, pyridoxal p, biosechs, hairoxal, pyromijin, vitazechs, hiadelon
| Color | White |
| Melting Point | 140°C |
| Identification | Pass Test |
| Assay Percent Range | ≥98% |
| Infrared Spectrum | Conforms to reference |
| Packaging | Amber Glass |
| Merck Index | 15, 8092 |
| Formula Weight | 247.14 |
| Physical Form | Powder/Solid |
| Chemical Name or Material | Pyridoxal 5-Phosphate, Monohydrate |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
