| CAS ID | 20595-30-6 |
|---|---|
| IUPAC Name | (E)-3-(3-fluorophenyl)prop-2-enoic acid |
| Molecular Formula | C9H7FO2 |
| Molecular Weight | |
| SMILES | C1=CC(=CC(=C1)F)C=CC(=O)O |
| CAS ID | 20595-30-6 |
|---|---|
| IUPAC Name | (E)-3-(3-fluorophenyl)prop-2-enoic acid |
| Molecular Formula | C9H7FO2 |
| Molecular Weight | |
| SMILES | C1=CC(=CC(=C1)F)C=CC(=O)O |
| 1551219 |
Synonym: 3-fluorocinnamic acid, 3-3-fluorophenyl acrylic acid, trans-3-fluorocinnamic acid, 2e-3-3-fluorophenyl prop-2-enoic acid, e-3-3-fluorophenyl acrylic acid, m-fluorocinnamic acid, trans 3-fluorocinnamic acid, 3-3-fluoro-phenyl-acrylic acid, trans-m-fluorocinnamic, e-3-3-fluorophenyl prop-2-enoic acid
| Odor | Odorless |
| Melting Point | 165°C to 168°C |
| Beilstein | 1365172 |
| Formula Weight | 166.15 |
| Chemical Name or Material | trans-3-Fluorocinnamic acid |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
