| CAS ID | 501-36-0 |
|---|---|
| IUPAC Name | 5-[(E)-2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol |
| Molecular Formula | C14H12O3 |
| Molecular Weight | |
| SMILES | C1=CC(=CC=C1C=CC2=CC(=CC(=C2)O)O)O |
| CAS ID | 501-36-0 |
|---|---|
| IUPAC Name | 5-[(E)-2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol |
| Molecular Formula | C14H12O3 |
| Molecular Weight | |
| SMILES | C1=CC(=CC=C1C=CC2=CC(=CC(=C2)O)O)O |
| 445154 |
Synonym: resveratrol, trans-resveratrol, 3,4′,5-trihydroxystilbene, 3,5,4′-trihydroxystilbene, e-resveratrol, 3,4′,5-stilbenetriol, e-5-4-hydroxystyryl benzene-1,3-diol, resvida, 3,4′,5-trihydroxy-trans-stilbene, 5-e-2-4-hydroxyphenyl ethenyl benzene-1,3-diol
| Color | Yellow |
| Melting Point | 267°C |
| Formula Weight | 228.25 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | Resveratrol |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
