| CAS ID | 35225-79-7 |
|---|---|
| IUPAC Name | (1E,4E)-1,5-diphenylpenta-1,4-dien-3-one |
| Molecular Formula | C17H14O |
| Molecular Weight | |
| SMILES | C1=CC=C(C=C1)C=CC(=O)C=CC2=CC=CC=C2 |
| CAS ID | 35225-79-7 |
|---|---|
| IUPAC Name | (1E,4E)-1,5-diphenylpenta-1,4-dien-3-one |
| Molecular Formula | C17H14O |
| Molecular Weight | |
| SMILES | C1=CC=C(C=C1)C=CC(=O)C=CC2=CC=CC=C2 |
| 640180 |
Synonym: dibenzylideneacetone, 1,5-diphenylpenta-1,4-dien-3-one, trans,trans-dibenzylideneacetone, dibenzalacetone, 1e,4e-1,5-diphenylpenta-1,4-dien-3-one, dibenzylidene acetone, distyryl ketone, 1,5-diphenyl-1,4-pentadien-3-one, trans,trans-dibenzalacetone, trans,trans-1,5-diphenyl-1,4-pentadien-3-one
| Melting Point | 113°C |
| Color | Undesignated |
| Formula Weight | 234.30 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | trans,trans-1,5-Diphenyl-1,4-pentadien-3-one |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
