| CAS ID | 58-72-0 |
|---|---|
| IUPAC Name | 1,2-diphenylethenylbenzene |
| Molecular Formula | C20H16 |
| Molecular Weight | |
| SMILES | C1=CC=C(C=C1)C=C(C2=CC=CC=C2)C3=CC=CC=C3 |
| CAS ID | 58-72-0 |
|---|---|
| IUPAC Name | 1,2-diphenylethenylbenzene |
| Molecular Formula | C20H16 |
| Molecular Weight | |
| SMILES | C1=CC=C(C=C1)C=C(C2=CC=CC=C2)C3=CC=CC=C3 |
| 6025 |
Synonym : triphenylethylene, triphenylethene, ethylene, triphenyl, benzilidenediphenylmethane, 1,1,2-triphenylethylene, ethene-1,1,2-triyltribenzene, 1,2-diphenylvinyl benzene, 1,2,2-triphenylethylene, benzene, 1,1′,1-1-ethenyl-2-ylidene tris, unii-s4zlz1k74b
| Color | White-Yellow |
| Melting Point | 69°C |
| Formula Weight | 256.35 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | Triphenylethylene |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
