| CAS ID | 603-35-0 |
|---|---|
| IUPAC Name | triphenylphosphane |
| Molecular Formula | C18H15P |
| Molecular Weight | |
| SMILES | C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1 |
| CAS ID | 603-35-0 |
|---|---|
| IUPAC Name | triphenylphosphane |
| Molecular Formula | C18H15P |
| Molecular Weight | |
| SMILES | C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1 |
| 11776 |
Synonym: triphenylphosphine, triphenyl phosphine, phosphine, triphenyl, triphenylphosphorus, triphenyl-phosphane, triphenylphosphide, phosphorustriphenyl, trifenylfosfin, trifenylfosfin czech, triphenylphosphine resin
| Melting Point | 81°C |
| Boiling Point | 260°C |
| Color | White |
| Formula Weight | 262.29 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | Triphenylphosphine |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
