| CAS ID | 2136-75-6 |
|---|---|
| IUPAC Name | 2-(triphenyl-$l^{5}-phosphanylidene)acetaldehyde |
| Molecular Formula | C20H17OP |
| Molecular Weight | |
| SMILES | C1=CC=C(C=C1)P(=CC=O)(C2=CC=CC=C2)C3=CC=CC=C3 |
| CAS ID | 2136-75-6 |
|---|---|
| IUPAC Name | 2-(triphenyl-$l^{5}-phosphanylidene)acetaldehyde |
| Molecular Formula | C20H17OP |
| Molecular Weight | |
| SMILES | C1=CC=C(C=C1)P(=CC=O)(C2=CC=CC=C2)C3=CC=CC=C3 |
| 75051 |
Synonym: 2-triphenylphosphoranylidene acetaldehyde, formylmethylene triphenylphosphorane, triphenylphosphoranylidene acetaldehyde, formylmethylenetriphenylphosphorane, acetaldehyde, triphenylphosphoranylidene, 2-triphenyl-??-phosphanylidene acetaldehyde, acmc-209fjg, ksc492c5l
| Color | Undesignated |
| Melting Point | 198°C |
| Formula Weight | 304.33 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | (Triphenylphosphoranylidene)acetaldehyde |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
