| CAS ID | 4731-65-1 |
|---|---|
| IUPAC Name | tris(2-methoxyphenyl)phosphane |
| Molecular Formula | C21H21O3P |
| Molecular Weight | |
| SMILES | COC1=CC=CC=C1P(C2=CC=CC=C2OC)C3=CC=CC=C3OC |
| CAS ID | 4731-65-1 |
|---|---|
| IUPAC Name | tris(2-methoxyphenyl)phosphane |
| Molecular Formula | C21H21O3P |
| Molecular Weight | |
| SMILES | COC1=CC=CC=C1P(C2=CC=CC=C2OC)C3=CC=CC=C3OC |
| 78464 |
Synonym : tris 2-methoxyphenyl phosphine, tris o-methoxyphenyl phosphine, tris 2-methoxyphenyl phosphane, phosphine, tris methoxyphenyl, tris-2-methoxyphenyl-phosphine, tris o-anisyl phosphine, tri-2-methoxyphenyl phosphine, pubchem19707, tri 2-methoxyphenyl phosphine, ksc286k3b
| Color | White-Yellow |
| Melting Point | 204°C |
| Formula Weight | 352.37 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | Tris(2-methoxyphenyl)phosphine |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
