| CAS ID | 78-42-2 |
|---|---|
| IUPAC Name | tris(2-ethylhexyl) phosphate |
| Molecular Formula | C24H51O4P |
| Molecular Weight | |
| SMILES | CCCCC(CC)COP(=O)(OCC(CC)CCCC)OCC(CC)CCCC |
| CAS ID | 78-42-2 |
|---|---|
| IUPAC Name | tris(2-ethylhexyl) phosphate |
| Molecular Formula | C24H51O4P |
| Molecular Weight | |
| SMILES | CCCCC(CC)COP(=O)(OCC(CC)CCCC)OCC(CC)CCCC |
| 6537 |
Synonym :tris 2-ethylhexyl phosphate, disflamoll tof, flexol tof, phosphoric acid, tris 2-ethylhexyl ester, kronitex tof, flexol plasticizer tof, 2-ethyl-1-hexanol phosphate, tris ethylhexyl phosphate, tri 2-ethylhexyl phosphate
| Color | Colorless |
| Boiling Point | 215°C |
| Formula Weight | 434.64 |
| Physical Form | Clear Liquid at 20°C |
| Chemical Name or Material | Tris(2-ethylhexyl) Phosphate |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
