| CAS ID | 3147-75-9 |
|---|---|
| IUPAC Name | 2-(2H-1,2,3-benzotriazol-2-yl)-4-(2,4,4-trimethylpentan-2-yl)phenol |
| Molecular Formula | N/A |
| Molecular Weight | |
| SMILES | CC(C)(C)CC(C)(C)C1=CC=C(O)C(=C1)N1N=C2C=CC=CC2=N1 |
| CAS ID | 3147-75-9 |
|---|---|
| IUPAC Name | 2-(2H-1,2,3-benzotriazol-2-yl)-4-(2,4,4-trimethylpentan-2-yl)phenol |
| Molecular Formula | N/A |
| Molecular Weight | |
| SMILES | CC(C)(C)CC(C)(C)C1=CC=C(O)C(=C1)N1N=C2C=CC=CC2=N1 |
| 62485 |
| Color | White-Yellow |
| Melting Point | 104°C |
| Formula Weight | 323.44 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 2-(2-Hydroxy-5-tert-octylphenyl)benzotriazole |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
