| CAS ID | 81-16-3 |
|---|---|
| IUPAC Name | 2-aminonaphthalene-1-sulfonic acid |
| Molecular Formula | C10H9NO3S |
| Molecular Weight | |
| SMILES | O=S(C1=C2C=CC=CC2=CC=C1N)(O)=O |
| CAS ID | 81-16-3 |
|---|---|
| IUPAC Name | 2-aminonaphthalene-1-sulfonic acid |
| Molecular Formula | C10H9NO3S |
| Molecular Weight | |
| SMILES | O=S(C1=C2C=CC=CC2=CC=C1N)(O)=O |
| PubChem CID | 6670 |
Synonyms
2-AMINO-1-NAPHTHALENESULFONIC ACID, 2-Naphthylamine-1-sulfonic acid, 2-aminonaphthalene-1-sulfonic acid, 81-16-3, 1-Naphthalenesulfonic acid, 2-amino-, Kyselina tobiasova
| Color | Undesignated |
| Formula Weight | 223.25 |
| Physical Form | Crystal-Powder at 20°C |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
2-Amino-1-Naphthalenesulfonic Acid is used as an intermediary in the manufacture of azo colours. Its sulfonic acid group increases water solubility, allowing more effective use in textile and industrial dyeing operations.
Because of its sensitivity to diverse environmental changes, 2-amino-1-naphthalenesulfonic Acid is used in environmental chemistry to identify contaminants and as a pH indicator in analytical testing.
2-Amino-1-Naphthalenesulfonic Acid is a useful reagent in chemical synthesis, notably for producing aromatic compounds. Its capacity to function as a nucleophile enables various substitution and addition processes.
Under typical laboratory conditions, 2-amino-1-naphthalenesulfonic Acid is relatively stable. Store it in a cool, dry area away from strong oxidising elements to avoid deterioration.
The solubility of 2-Amino-1-Naphthalenesulfonic Acid in water makes it appropriate for aqueous-based reactions, allowing it to be employed efficiently in dye formulations, buffers, and as an intermediate in aqueous chemical processes.
