| CAS ID | 7128-64-5 |
|---|---|
| IUPAC Name | Optical Brightener OB (C.I. 184) |
| Molecular Formula | N/A |
| Molecular Weight | |
| SMILES | CC(C)(C)C1=CC2=C(C=C1)OC(=N2)C3=CC=C(S3)C4=NC5=C(O4)C=CC(=C5)C(C)(C)C |
| CAS ID | 7128-64-5 |
|---|---|
| IUPAC Name | Optical Brightener OB (C.I. 184) |
| Molecular Formula | N/A |
| Molecular Weight | |
| SMILES | CC(C)(C)C1=CC2=C(C=C1)OC(=N2)C3=CC=C(S3)C4=NC5=C(O4)C=CC(=C5)C(C)(C)C |
| 292429 |
Synonym : bbot, 2,5-bis 5-tert-butyl-2-benzoxazolyl thiophene, uvitex ob, 2,5-bis 5-tert-butyl benzo d oxazol-2-yl thiophene, bbot 150, 2,5-bis 5-tert-butylbenzoxazol-2-yl thiophene, benzoxazole, 2,2′-2,5-thiophenediyl bis 5-1,1-dimethylethyl, unii-w7ur9129gp, fluorescent brightener 184, 2,2′-2,5-thiophenediyl bis 5-tert-butylbenzoxazole
| Melting Point | 202°C |
| Color | Undesignated |
| Formula Weight | 430.57 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 2,5-Bis(5-tert-butyl-2-benzoxazolyl)thiophene (purified by sublimation) |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
